C24H24FNO2 — CID 20571394
(3-phenoxyphenyl)methyl 2-(4-fluorophenyl)-3-methylbutanimidate (PubChem CID 20571394) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 2-(4-fluorophenyl)-3-methylbutanimidate.
| Compound Name | (3-phenoxyphenyl)methyl 2-(4-fluorophenyl)-3-methylbutanimidate |
|---|---|
| PubChem CID | 20571394 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (3-phenoxyphenyl)methyl 2-(4-fluorophenyl)-3-methylbutanimidate |
| SMILES | [H]/N=C(\OCc1cccc(Oc2ccccc2)c1)C(c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C24H24FNO2/c1-17(2)23(19-11-13-20(25)14-12-19)24(26)27-16-18-7-6-10-22(15-18)28-21-8-4-3-5-9-21/h3-15,17,23,26H,16H2,1-2H3/b26-24- |
| InChIKey | GVARQUSNZFJLNW-LCUIJRPUSA-N |
| XLogP | 6.55 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|