About 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate
4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate (PubChem CID 91728342) has the molecular formula C21H24O5
and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate.
Molecular Properties
| Compound Name | 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate |
| PubChem CID | 91728342 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate |
| SMILES | CC(C)COC(=O)CCC(=O)OCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24O5/c1-16(2)14-24-20(22)12-13-21(23)25-15-17-8-10-19(11-9-17)26-18-6-4-3-5-7-18/h3-11,16H,12-15H2,1-2H3 |
| InChIKey | LUVCBMAVBVHVKQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate?
The IUPAC name of 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate (CID 91728342) is 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate.
What is the SMILES notation for 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate?
The canonical SMILES for 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate is CC(C)COC(=O)CCC(=O)OCc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate?
The InChIKey is LUVCBMAVBVHVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O5/c1-16(2)14-24-20(22)12-13-21(23)25-15-17-8-10-19(11-9-17)26-18-6-4-3-5-7-18/h3-11,16H,12-15H2,1-2H3.
What are the key properties of 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate?
4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate has a molecular weight of 356.42 g/mol, XLogP of 4.50, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-methylpropyl) 1-O-[(4-phenoxyphenyl)methyl] butanedioate is sourced from PubChem (CID 91728342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).