C35H34N2O7 — CID 54439689
dibenzyl (2S)-2-[[(2S)-2-[(4-phenoxybenzoyl)amino]propanoyl]amino]pentanedioate (PubChem CID 54439689) has the molecular formula C35H34N2O7 and a molecular weight of 594.66 g/mol. Its IUPAC name is dibenzyl (2S)-2-[[(2S)-2-[(4-phenoxybenzoyl)amino]propanoyl]amino]pentanedioate.
| Compound Name | dibenzyl (2S)-2-[[(2S)-2-[(4-phenoxybenzoyl)amino]propanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 54439689 |
| Molecular Formula | C35H34N2O7 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | dibenzyl (2S)-2-[[(2S)-2-[(4-phenoxybenzoyl)amino]propanoyl]amino]pentanedioate |
| SMILES | C[C@H](NC(=O)c1ccc(Oc2ccccc2)cc1)C(=O)N[C@@H](CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H34N2O7/c1-25(36-34(40)28-17-19-30(20-18-28)44-29-15-9-4-10-16-29)33(39)37-31(35(41)43-24-27-13-7-3-8-14-27)21-22-32(38)42-23-26-11-5-2-6-12-26/h2-20,25,31H,21-24H2,1H3,(H,36,40)(H,37,39)/t25-,31-/m0/s1 |
| InChIKey | WNFKJRVMUFBXGN-FKAPRUDGSA-N |
| XLogP | 5.35 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |