C11H18N2O3S — CID 114160164
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-pent-4-ynylacetamide (PubChem CID 114160164) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-pent-4-ynylacetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-pent-4-ynylacetamide |
|---|---|
| PubChem CID | 114160164 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-pent-4-ynylacetamide |
| SMILES | C#CCCCNC(=O)CC1CS(=O)(=O)CCN1 |
| InChI | InChI=1S/C11H18N2O3S/c1-2-3-4-5-13-11(14)8-10-9-17(15,16)7-6-12-10/h1,10,12H,3-9H2,(H,13,14) |
| InChIKey | CTOOAGFLWVVYNN-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|