C24H31FN6O2S — CID 72545612
2-[[1-(4-fluorophenyl)-4-morpholin-4-ylbutan-2-yl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 72545612) has the molecular formula C24H31FN6O2S and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-[[1-(4-fluorophenyl)-4-morpholin-4-ylbutan-2-yl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[1-(4-fluorophenyl)-4-morpholin-4-ylbutan-2-yl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 72545612 |
| Molecular Formula | C24H31FN6O2S |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 2-[[1-(4-fluorophenyl)-4-morpholin-4-ylbutan-2-yl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1cnc(NC(CCN2CCOCC2)Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C24H31FN6O2S/c25-20-4-2-19(3-5-20)16-21(6-10-30-12-14-33-15-13-30)29-24-28-17-22(34-24)23(32)27-7-1-9-31-11-8-26-18-31/h2-5,8,11,17-18,21H,1,6-7,9-10,12-16H2,(H,27,32)(H,28,29) |
| InChIKey | KSOZPMRKUOEFCL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|