C18H16FN3O3 — CID 134405482
[2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] 2-(2-methyl-1H-indol-3-yl)acetate (PubChem CID 134405482) has the molecular formula C18H16FN3O3 and a molecular weight of 341.34 g/mol. Its IUPAC name is [2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] 2-(2-methyl-1H-indol-3-yl)acetate.
| Compound Name | [2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] 2-(2-methyl-1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 134405482 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | [2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] 2-(2-methyl-1H-indol-3-yl)acetate |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)OCC(=O)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C18H16FN3O3/c1-11-14(13-4-2-3-5-15(13)21-11)8-18(24)25-10-17(23)22-16-7-6-12(19)9-20-16/h2-7,9,21H,8,10H2,1H3,(H,20,22,23) |
| InChIKey | ZUAMTQCHYALMRM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|