C23H25N3O4 — CID 38330775
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(2-methyl-1H-indol-3-yl)acetate (PubChem CID 38330775) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(2-methyl-1H-indol-3-yl)acetate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(2-methyl-1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 38330775 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-(2-methyl-1H-indol-3-yl)acetate |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)OCC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-16-20(19-4-2-3-5-21(19)24-16)14-23(28)30-15-22(27)25-17-6-8-18(9-7-17)26-10-12-29-13-11-26/h2-9,24H,10-15H2,1H3,(H,25,27) |
| InChIKey | WQEHRBMZUZWRJN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|