C17H18N4O6 — CID 3921616
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate (PubChem CID 3921616) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3921616 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)[nH]c(=O)[nH]1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H18N4O6/c22-14-9-13(19-17(25)20-14)16(24)27-10-15(23)18-11-1-3-12(4-2-11)21-5-7-26-8-6-21/h1-4,9H,5-8,10H2,(H,18,23)(H2,19,20,22,25) |
| InChIKey | LQGCYDULKBOEHG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|