C18H19ClF3N3O2 — CID 55617715
2-(4-chloro-2-methylphenoxy)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]propanamide (PubChem CID 55617715) has the molecular formula C18H19ClF3N3O2 and a molecular weight of 401.82 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]propanamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 55617715 |
| Molecular Formula | C18H19ClF3N3O2 |
| Molecular Weight | 401.82 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]propanamide |
| SMILES | Cc1cc(Cl)ccc1OC(C)C(=O)NCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H19ClF3N3O2/c1-11-9-14(19)4-5-15(11)27-12(2)17(26)24-8-7-23-16-6-3-13(10-25-16)18(20,21)22/h3-6,9-10,12H,7-8H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | JZBMYUHJWGQPMZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|