C20H26ClN3O2 — CID 51725187
(2R)-2-(4-chloro-2-methylphenoxy)-N-[[6-(diethylamino)-3-pyridinyl]methyl]propanamide (PubChem CID 51725187) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is (2R)-2-(4-chloro-2-methylphenoxy)-N-[[6-(diethylamino)-3-pyridinyl]methyl]propanamide.
| Compound Name | (2R)-2-(4-chloro-2-methylphenoxy)-N-[[6-(diethylamino)-3-pyridinyl]methyl]propanamide |
|---|---|
| PubChem CID | 51725187 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2R)-2-(4-chloro-2-methylphenoxy)-N-[[6-(diethylamino)-3-pyridinyl]methyl]propanamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)[C@@H](C)Oc2ccc(Cl)cc2C)cn1 |
| InChI | InChI=1S/C20H26ClN3O2/c1-5-24(6-2)19-10-7-16(12-22-19)13-23-20(25)15(4)26-18-9-8-17(21)11-14(18)3/h7-12,15H,5-6,13H2,1-4H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | MIBPUWYCKZTTSK-OAHLLOKOSA-N |
| XLogP | 3.97 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |