C16H23N5O — CID 94176903
(2R)-N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-pyrazol-1-ylpropanamide (PubChem CID 94176903) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is (2R)-N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-pyrazol-1-ylpropanamide.
| Compound Name | (2R)-N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 94176903 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | (2R)-N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-pyrazol-1-ylpropanamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)[C@@H](C)n2cccn2)cn1 |
| InChI | InChI=1S/C16H23N5O/c1-4-20(5-2)15-8-7-14(11-17-15)12-18-16(22)13(3)21-10-6-9-19-21/h6-11,13H,4-5,12H2,1-3H3,(H,18,22)/t13-/m1/s1 |
| InChIKey | AGDNBAIIAVQGHU-CYBMUJFWSA-N |
| XLogP | 2.00 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |