C16H28N4O2 — CID 111454346
1-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(4-hydroxy-3-methylbutan-2-yl)urea (PubChem CID 111454346) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(4-hydroxy-3-methylbutan-2-yl)urea.
| Compound Name | 1-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(4-hydroxy-3-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 111454346 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(4-hydroxy-3-methylbutan-2-yl)urea |
| SMILES | CCN(CC)c1ccc(CNC(=O)NC(C)C(C)CO)cn1 |
| InChI | InChI=1S/C16H28N4O2/c1-5-20(6-2)15-8-7-14(9-17-15)10-18-16(22)19-13(4)12(3)11-21/h7-9,12-13,21H,5-6,10-11H2,1-4H3,(H2,18,19,22) |
| InChIKey | MUGLYQAEBARFKR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |