C20H32N3O2S+ — CID 11944464
2-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]acetamide (PubChem CID 11944464) has the molecular formula C20H32N3O2S+ and a molecular weight of 378.56 g/mol. Its IUPAC name is 2-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]acetamide.
| Compound Name | 2-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 11944464 |
| Molecular Formula | C20H32N3O2S+ |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-N-[3-[(2R)-2-methylpiperidin-1-ium-1-yl]propyl]acetamide |
| SMILES | Cc1cccc(NC(=O)CSCC(=O)NCCC[NH+]2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C20H31N3O2S/c1-16-7-5-9-18(13-16)22-20(25)15-26-14-19(24)21-10-6-12-23-11-4-3-8-17(23)2/h5,7,9,13,17H,3-4,6,8,10-12,14-15H2,1-2H3,(H,21,24)(H,22,25)/p+1/t17-/m1/s1 |
| InChIKey | SQRVUBGHSTVWHS-QGZVFWFLSA-O |
| XLogP | 1.63 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|