C19H14F4N2O2S — CID 55545508
4-fluoro-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 55545508) has the molecular formula C19H14F4N2O2S and a molecular weight of 410.39 g/mol. Its IUPAC name is 4-fluoro-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55545508 |
| Molecular Formula | C19H14F4N2O2S |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 4-fluoro-N-[2-[[4-(trifluoromethyl)benzoyl]amino]ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cc2c(F)cccc2s1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F4N2O2S/c20-14-2-1-3-15-13(14)10-16(28-15)18(27)25-9-8-24-17(26)11-4-6-12(7-5-11)19(21,22)23/h1-7,10H,8-9H2,(H,24,26)(H,25,27) |
| InChIKey | MNNULSWDOQYMNQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|