C13H12FNO4S — CID 107832289
4-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]-2-hydroxybutanoic acid (PubChem CID 107832289) has the molecular formula C13H12FNO4S and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]-2-hydroxybutanoic acid.
| Compound Name | 4-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107832289 |
| Molecular Formula | C13H12FNO4S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 4-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]-2-hydroxybutanoic acid |
| SMILES | O=C(NCCC(O)C(=O)O)c1cc2c(F)cccc2s1 |
| InChI | InChI=1S/C13H12FNO4S/c14-8-2-1-3-10-7(8)6-11(20-10)12(17)15-5-4-9(16)13(18)19/h1-3,6,9,16H,4-5H2,(H,15,17)(H,18,19) |
| InChIKey | RRSOFBVRGFCGCZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |