C13H12FNO4S — CID 66172399
3-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66172399) has the molecular formula C13H12FNO4S and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66172399 |
| Molecular Formula | C13H12FNO4S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNC(=O)c1cc2c(F)cccc2s1)C(=O)O |
| InChI | InChI=1S/C13H12FNO4S/c1-13(19,12(17)18)6-15-11(16)10-5-7-8(14)3-2-4-9(7)20-10/h2-5,19H,6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | CTDWUTMOBZPJPQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |