C19H17FN2O2S — CID 55782825
N-[5-(ethylcarbamoyl)-2-methylphenyl]-4-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 55782825) has the molecular formula C19H17FN2O2S and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[5-(ethylcarbamoyl)-2-methylphenyl]-4-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[5-(ethylcarbamoyl)-2-methylphenyl]-4-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55782825 |
| Molecular Formula | C19H17FN2O2S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[5-(ethylcarbamoyl)-2-methylphenyl]-4-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(C)c(NC(=O)c2cc3c(F)cccc3s2)c1 |
| InChI | InChI=1S/C19H17FN2O2S/c1-3-21-18(23)12-8-7-11(2)15(9-12)22-19(24)17-10-13-14(20)5-4-6-16(13)25-17/h4-10H,3H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | WTMRUPTWBJLIOC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |