C15H9ClFNOS — CID 31495952
N-(2-chlorophenyl)-4-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 31495952) has the molecular formula C15H9ClFNOS and a molecular weight of 305.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 31495952 |
| Molecular Formula | C15H9ClFNOS |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | N-(2-chlorophenyl)-4-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1cc2c(F)cccc2s1 |
| InChI | InChI=1S/C15H9ClFNOS/c16-10-4-1-2-6-12(10)18-15(19)14-8-9-11(17)5-3-7-13(9)20-14/h1-8H,(H,18,19) |
| InChIKey | REBRFNKWUULARW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |