C16H12ClFN2O3S2 — CID 169144861
N-[3-chloro-5-(methanesulfonamido)phenyl]-4-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 169144861) has the molecular formula C16H12ClFN2O3S2 and a molecular weight of 398.87 g/mol. Its IUPAC name is N-[3-chloro-5-(methanesulfonamido)phenyl]-4-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-chloro-5-(methanesulfonamido)phenyl]-4-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 169144861 |
| Molecular Formula | C16H12ClFN2O3S2 |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | N-[3-chloro-5-(methanesulfonamido)phenyl]-4-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1cc(Cl)cc(NC(=O)c2cc3c(F)cccc3s2)c1 |
| InChI | InChI=1S/C16H12ClFN2O3S2/c1-25(22,23)20-11-6-9(17)5-10(7-11)19-16(21)15-8-12-13(18)3-2-4-14(12)24-15/h2-8,20H,1H3,(H,19,21) |
| InChIKey | DONGMUYCHAVHLY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |