C18H15FN2O3S2 — CID 33310920
N-[3-(cyclopropylsulfamoyl)phenyl]-4-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 33310920) has the molecular formula C18H15FN2O3S2 and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)phenyl]-4-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)phenyl]-4-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 33310920 |
| Molecular Formula | C18H15FN2O3S2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)phenyl]-4-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NC2CC2)c1)c1cc2c(F)cccc2s1 |
| InChI | InChI=1S/C18H15FN2O3S2/c19-15-5-2-6-16-14(15)10-17(25-16)18(22)20-12-3-1-4-13(9-12)26(23,24)21-11-7-8-11/h1-6,9-11,21H,7-8H2,(H,20,22) |
| InChIKey | DWPJJVMXJNZTHS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |