C17H11F2NO3S — CID 30469108
methyl 2-fluoro-5-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]benzoate (PubChem CID 30469108) has the molecular formula C17H11F2NO3S and a molecular weight of 347.34 g/mol. Its IUPAC name is methyl 2-fluoro-5-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]benzoate.
| Compound Name | methyl 2-fluoro-5-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 30469108 |
| Molecular Formula | C17H11F2NO3S |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | methyl 2-fluoro-5-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2cc3c(F)cccc3s2)ccc1F |
| InChI | InChI=1S/C17H11F2NO3S/c1-23-17(22)11-7-9(5-6-13(11)19)20-16(21)15-8-10-12(18)3-2-4-14(10)24-15/h2-8H,1H3,(H,20,21) |
| InChIKey | MGAGFLBFBQNSNC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |