C19H15FN2O4S — CID 34073469
methyl 2-[[4-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]benzoyl]amino]acetate (PubChem CID 34073469) has the molecular formula C19H15FN2O4S and a molecular weight of 386.40 g/mol. Its IUPAC name is methyl 2-[[4-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 34073469 |
| Molecular Formula | C19H15FN2O4S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | methyl 2-[[4-[(4-fluoro-1-benzothiophene-2-carbonyl)amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)c2cc3c(F)cccc3s2)cc1 |
| InChI | InChI=1S/C19H15FN2O4S/c1-26-17(23)10-21-18(24)11-5-7-12(8-6-11)22-19(25)16-9-13-14(20)3-2-4-15(13)27-16/h2-9H,10H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | XCRUTMYGONGHQO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |