C15H24N2O4S — CID 27680670
N-(3-ethoxypropyl)-3,4-dimethyl-5-(methylsulfamoyl)benzamide (PubChem CID 27680670) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3,4-dimethyl-5-(methylsulfamoyl)benzamide.
| Compound Name | N-(3-ethoxypropyl)-3,4-dimethyl-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 27680670 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-(3-ethoxypropyl)-3,4-dimethyl-5-(methylsulfamoyl)benzamide |
| SMILES | CCOCCCNC(=O)c1cc(C)c(C)c(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C15H24N2O4S/c1-5-21-8-6-7-17-15(18)13-9-11(2)12(3)14(10-13)22(19,20)16-4/h9-10,16H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | PHOOGVFXNKKSPI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|