C14H22N2O3S — CID 27539196
3,4-dimethyl-N-(2-methylpropyl)-5-(methylsulfamoyl)benzamide (PubChem CID 27539196) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 3,4-dimethyl-N-(2-methylpropyl)-5-(methylsulfamoyl)benzamide.
| Compound Name | 3,4-dimethyl-N-(2-methylpropyl)-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 27539196 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3,4-dimethyl-N-(2-methylpropyl)-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NCC(C)C)cc(C)c1C |
| InChI | InChI=1S/C14H22N2O3S/c1-9(2)8-16-14(17)12-6-10(3)11(4)13(7-12)20(18,19)15-5/h6-7,9,15H,8H2,1-5H3,(H,16,17) |
| InChIKey | JVVOXRNBCZBOHX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |