C18H30N2O3S — CID 32648511
3,4-dimethyl-N-[(2S)-6-methylheptan-2-yl]-5-(methylsulfamoyl)benzamide (PubChem CID 32648511) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(2S)-6-methylheptan-2-yl]-5-(methylsulfamoyl)benzamide.
| Compound Name | 3,4-dimethyl-N-[(2S)-6-methylheptan-2-yl]-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 32648511 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 3,4-dimethyl-N-[(2S)-6-methylheptan-2-yl]-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N[C@@H](C)CCCC(C)C)cc(C)c1C |
| InChI | InChI=1S/C18H30N2O3S/c1-12(2)8-7-9-14(4)20-18(21)16-10-13(3)15(5)17(11-16)24(22,23)19-6/h10-12,14,19H,7-9H2,1-6H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | KUQYQLBRPSMWRB-AWEZNQCLSA-N |
| XLogP | 3.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |