C22H32N2O3S — CID 46560476
N-[1-(1-adamantyl)ethyl]-3,4-dimethyl-5-(methylsulfamoyl)benzamide (PubChem CID 46560476) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-3,4-dimethyl-5-(methylsulfamoyl)benzamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-3,4-dimethyl-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46560476 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-3,4-dimethyl-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NC(C)C23CC4CC(CC(C4)C2)C3)cc(C)c1C |
| InChI | InChI=1S/C22H32N2O3S/c1-13-5-19(9-20(14(13)2)28(26,27)23-4)21(25)24-15(3)22-10-16-6-17(11-22)8-18(7-16)12-22/h5,9,15-18,23H,6-8,10-12H2,1-4H3,(H,24,25) |
| InChIKey | BTPCIRRGLHRTRP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |