C20H22N4O2 — CID 133345456
6-[[4-(2-oxopyrrolidin-1-yl)phenyl]methylamino]-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 133345456) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 6-[[4-(2-oxopyrrolidin-1-yl)phenyl]methylamino]-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 6-[[4-(2-oxopyrrolidin-1-yl)phenyl]methylamino]-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133345456 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 6-[[4-(2-oxopyrrolidin-1-yl)phenyl]methylamino]-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(NCc2ccc(N3CCCC3=O)cc2)nc1 |
| InChI | InChI=1S/C20H22N4O2/c1-2-11-21-20(26)16-7-10-18(23-14-16)22-13-15-5-8-17(9-6-15)24-12-3-4-19(24)25/h2,5-10,14H,1,3-4,11-13H2,(H,21,26)(H,22,23) |
| InChIKey | DFDLTHYREKSYLW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|