About ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate
ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate (PubChem CID 166301269) has the molecular formula C14H15F3N4O3
and a molecular weight of 344.29 g/mol. Its IUPAC name is ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate |
| PubChem CID | 166301269 |
| Molecular Formula | C14H15F3N4O3 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCNc2ccc(C(F)(F)F)cn2)o1 |
| InChI | InChI=1S/C14H15F3N4O3/c1-2-23-12(22)10-8-21-13(24-10)19-6-5-18-11-4-3-9(7-20-11)14(15,16)17/h3-4,7-8H,2,5-6H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | RVKFKNXPNBCZGD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate?
The IUPAC name of ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate (CID 166301269) is ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate?
The canonical SMILES for ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate is CCOC(=O)c1cnc(NCCNc2ccc(C(F)(F)F)cn2)o1.
What is the InChIKey of ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate?
The InChIKey is RVKFKNXPNBCZGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N4O3/c1-2-23-12(22)10-8-21-13(24-10)19-6-5-18-11-4-3-9(7-20-11)14(15,16)17/h3-4,7-8H,2,5-6H2,1H3,(H,18,20)(H,19,21).
What are the key properties of ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate?
ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate has a molecular weight of 344.29 g/mol, XLogP of 2.79, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 166301269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).