C18H17F3N4OS2 — CID 46473451
2-(2-thiophen-3-yl-1,3-thiazol-4-yl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]acetamide (PubChem CID 46473451) has the molecular formula C18H17F3N4OS2 and a molecular weight of 426.49 g/mol. Its IUPAC name is 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]acetamide.
| Compound Name | 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 46473451 |
| Molecular Formula | C18H17F3N4OS2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]acetamide |
| SMILES | O=C(Cc1csc(-c2ccsc2)n1)NCCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H17F3N4OS2/c19-18(20,21)13-2-3-15(24-9-13)22-5-1-6-23-16(26)8-14-11-28-17(25-14)12-4-7-27-10-12/h2-4,7,9-11H,1,5-6,8H2,(H,22,24)(H,23,26) |
| InChIKey | LODDHMBHMLIWHT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|