C14H18N2O2S2 — CID 115703692
N-(3-hydroxypentyl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 115703692) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is N-(3-hydroxypentyl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(3-hydroxypentyl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 115703692 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(3-hydroxypentyl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCC(O)CCNC(=O)Cc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-2-12(17)3-5-15-13(18)7-11-9-20-14(16-11)10-4-6-19-8-10/h4,6,8-9,12,17H,2-3,5,7H2,1H3,(H,15,18) |
| InChIKey | CFVPWEGBTOIUEF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |