C28H49N3O2S2 — CID 58167743
3-oxo-5-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanyl-4-(1,3-thiazol-2-ylamino)pentanamide (PubChem CID 58167743) has the molecular formula C28H49N3O2S2 and a molecular weight of 523.85 g/mol. Its IUPAC name is 3-oxo-5-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanyl-4-(1,3-thiazol-2-ylamino)pentanamide.
| Compound Name | 3-oxo-5-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanyl-4-(1,3-thiazol-2-ylamino)pentanamide |
|---|---|
| PubChem CID | 58167743 |
| Molecular Formula | C28H49N3O2S2 |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | 3-oxo-5-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanyl-4-(1,3-thiazol-2-ylamino)pentanamide |
| SMILES | C/C(=C\CSCC(Nc1nccs1)C(=O)CC(N)=O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C28H49N3O2S2/c1-21(2)9-6-10-22(3)11-7-12-23(4)13-8-14-24(5)15-17-34-20-25(26(32)19-27(29)33)31-28-30-16-18-35-28/h15-16,18,21-23,25H,6-14,17,19-20H2,1-5H3,(H2,29,33)(H,30,31)/b24-15+ |
| InChIKey | JRIDOHPQXIXYRW-BUVRLJJBSA-N |
| XLogP | 7.49 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|