C23H36N4O4S — CID 135232015
2-[[[carboxymethyl(methyl)amino]-(cyanoamino)methylidene]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 135232015) has the molecular formula C23H36N4O4S and a molecular weight of 464.63 g/mol. Its IUPAC name is 2-[[[carboxymethyl(methyl)amino]-(cyanoamino)methylidene]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | 2-[[[carboxymethyl(methyl)amino]-(cyanoamino)methylidene]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 135232015 |
| Molecular Formula | C23H36N4O4S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 2-[[[carboxymethyl(methyl)amino]-(cyanoamino)methylidene]amino]-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC(/N=C(\NC#N)N(C)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H36N4O4S/c1-17(2)8-6-9-18(3)10-7-11-19(4)12-13-32-15-20(22(30)31)26-23(25-16-24)27(5)14-21(28)29/h8,10,12,20H,6-7,9,11,13-15H2,1-5H3,(H,25,26)(H,28,29)(H,30,31)/b18-10+,19-12+ |
| InChIKey | HKNJMAPNQVYCSO-UBIAKTOFSA-N |
| XLogP | 4.04 |
| TPSA | 126.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|