C27H48N2S — CID 134568521
3-N-ethenyl-2-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hept-1-ene-2,3-diamine (PubChem CID 134568521) has the molecular formula C27H48N2S and a molecular weight of 432.76 g/mol. Its IUPAC name is 3-N-ethenyl-2-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hept-1-ene-2,3-diamine.
| Compound Name | 3-N-ethenyl-2-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hept-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 134568521 |
| Molecular Formula | C27H48N2S |
| Molecular Weight | 432.76 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 3-N-ethenyl-2-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hept-1-ene-2,3-diamine |
| SMILES | C=CNC(CCCC)C(=C)NC(C)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C27H48N2S/c1-9-11-18-27(28-10-2)26(8)29-25(7)21-30-20-19-24(6)17-13-16-23(5)15-12-14-22(3)4/h10,14,16,19,25,27-29H,2,8-9,11-13,15,17-18,20-21H2,1,3-7H3/b23-16+,24-19+ |
| InChIKey | ZOCAOSRWCMVXTD-FXSINEHXSA-N |
| XLogP | 7.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.76 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|