C34H48NO5P — CID 144735106
[4-(2-diethoxyphosphanyloxyethyl)phenyl] 2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoate (PubChem CID 144735106) has the molecular formula C34H48NO5P and a molecular weight of 581.73 g/mol. Its IUPAC name is [4-(2-diethoxyphosphanyloxyethyl)phenyl] 2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoate.
| Compound Name | [4-(2-diethoxyphosphanyloxyethyl)phenyl] 2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoate |
|---|---|
| PubChem CID | 144735106 |
| Molecular Formula | C34H48NO5P |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | [4-(2-diethoxyphosphanyloxyethyl)phenyl] 2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoate |
| SMILES | CCOP(OCC)OCCc1ccc(OC(=O)c2ccccc2NC/C=C(\C)CC/C=C(\C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C34H48NO5P/c1-7-37-41(38-8-2)39-26-24-30-19-21-31(22-20-30)40-34(36)32-17-9-10-18-33(32)35-25-23-29(6)16-12-15-28(5)14-11-13-27(3)4/h9-10,13,15,17-23,35H,7-8,11-12,14,16,24-26H2,1-6H3/b28-15+,29-23+ |
| InChIKey | VYDYOWQUCHQBAN-SUTOAXABSA-N |
| XLogP | 9.60 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|