C23H32O2 — CID 154133238
ethyl 2-[(1Z)-2,6,10-trimethylundeca-1,5,9-trienyl]benzoate (PubChem CID 154133238) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is ethyl 2-[(1Z)-2,6,10-trimethylundeca-1,5,9-trienyl]benzoate.
| Compound Name | ethyl 2-[(1Z)-2,6,10-trimethylundeca-1,5,9-trienyl]benzoate |
|---|---|
| PubChem CID | 154133238 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | ethyl 2-[(1Z)-2,6,10-trimethylundeca-1,5,9-trienyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1/C=C(/C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C23H32O2/c1-6-25-23(24)22-16-8-7-15-21(22)17-20(5)14-10-13-19(4)12-9-11-18(2)3/h7-8,11,13,15-17H,6,9-10,12,14H2,1-5H3/b19-13?,20-17- |
| InChIKey | PMVSQPRLXDSCBY-KXFJXNMDSA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|