C26H40N2O2 — CID 143171095
[(6E)-3,3,7,11-tetramethyldodeca-6,10-dienyl] 2-[2-(ethylamino)phenyl]-2-iminoacetate (PubChem CID 143171095) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is [(6E)-3,3,7,11-tetramethyldodeca-6,10-dienyl] 2-[2-(ethylamino)phenyl]-2-iminoacetate.
| Compound Name | [(6E)-3,3,7,11-tetramethyldodeca-6,10-dienyl] 2-[2-(ethylamino)phenyl]-2-iminoacetate |
|---|---|
| PubChem CID | 143171095 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | [(6E)-3,3,7,11-tetramethyldodeca-6,10-dienyl] 2-[2-(ethylamino)phenyl]-2-iminoacetate |
| SMILES | [H]/N=C(\C(=O)OCCC(C)(C)CC/C=C(\C)CCC=C(C)C)c1ccccc1NCC |
| InChI | InChI=1S/C26H40N2O2/c1-7-28-23-16-9-8-15-22(23)24(27)25(29)30-19-18-26(5,6)17-11-14-21(4)13-10-12-20(2)3/h8-9,12,14-16,27-28H,7,10-11,13,17-19H2,1-6H3/b21-14+,27-24- |
| InChIKey | AAWSODYFHZNUAI-ZDGMEELJSA-N |
| XLogP | 6.92 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|