C19H33N5O8P2 — CID 140554042
methyl 2-[[(2E,6E)-9,9-bis(diaminooxyphosphoryl)-2,6-dimethylnona-2,6-dienyl]amino]benzoate (PubChem CID 140554042) has the molecular formula C19H33N5O8P2 and a molecular weight of 521.45 g/mol. Its IUPAC name is methyl 2-[[(2E,6E)-9,9-bis(diaminooxyphosphoryl)-2,6-dimethylnona-2,6-dienyl]amino]benzoate.
| Compound Name | methyl 2-[[(2E,6E)-9,9-bis(diaminooxyphosphoryl)-2,6-dimethylnona-2,6-dienyl]amino]benzoate |
|---|---|
| PubChem CID | 140554042 |
| Molecular Formula | C19H33N5O8P2 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | methyl 2-[[(2E,6E)-9,9-bis(diaminooxyphosphoryl)-2,6-dimethylnona-2,6-dienyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC/C(C)=C/CC/C(C)=C/CC(P(=O)(ON)ON)P(=O)(ON)ON |
| InChI | InChI=1S/C19H33N5O8P2/c1-14(11-12-18(33(26,29-20)30-21)34(27,31-22)32-23)7-6-8-15(2)13-24-17-10-5-4-9-16(17)19(25)28-3/h4-5,8-11,18,24H,6-7,12-13,20-23H2,1-3H3/b14-11+,15-8+ |
| InChIKey | BVVJUOYCMAMXTF-GGQZXFEVSA-N |
| XLogP | 3.22 |
| TPSA | 213.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|