C28H38N2O5 — CID 121396260
methyl 2-[[9-hydroxy-1-(2-methoxycarbonylanilino)-5,9-dimethyldec-4-enyl]amino]benzoate (PubChem CID 121396260) has the molecular formula C28H38N2O5 and a molecular weight of 482.62 g/mol. Its IUPAC name is methyl 2-[[9-hydroxy-1-(2-methoxycarbonylanilino)-5,9-dimethyldec-4-enyl]amino]benzoate.
| Compound Name | methyl 2-[[9-hydroxy-1-(2-methoxycarbonylanilino)-5,9-dimethyldec-4-enyl]amino]benzoate |
|---|---|
| PubChem CID | 121396260 |
| Molecular Formula | C28H38N2O5 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | methyl 2-[[9-hydroxy-1-(2-methoxycarbonylanilino)-5,9-dimethyldec-4-enyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(CCC=C(C)CCCC(C)(C)O)Nc1ccccc1C(=O)OC |
| InChI | InChI=1S/C28H38N2O5/c1-20(13-11-19-28(2,3)33)12-10-18-25(29-23-16-8-6-14-21(23)26(31)34-4)30-24-17-9-7-15-22(24)27(32)35-5/h6-9,12,14-17,25,29-30,33H,10-11,13,18-19H2,1-5H3 |
| InChIKey | QSEJUWVDEAZNNN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|