C17H26O2SSi — CID 6421168
3-(3-methylbut-2-enyl)-2-(2-trimethylsilylethylsulfanyl)benzoic acid (PubChem CID 6421168) has the molecular formula C17H26O2SSi and a molecular weight of 322.55 g/mol. Its IUPAC name is 3-(3-methylbut-2-enyl)-2-(2-trimethylsilylethylsulfanyl)benzoic acid.
| Compound Name | 3-(3-methylbut-2-enyl)-2-(2-trimethylsilylethylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 6421168 |
| Molecular Formula | C17H26O2SSi |
| Molecular Weight | 322.55 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-(3-methylbut-2-enyl)-2-(2-trimethylsilylethylsulfanyl)benzoic acid |
| SMILES | CC(C)=CCc1cccc(C(=O)O)c1SCC[Si](C)(C)C |
| InChI | InChI=1S/C17H26O2SSi/c1-13(2)9-10-14-7-6-8-15(17(18)19)16(14)20-11-12-21(3,4)5/h6-9H,10-12H2,1-5H3,(H,18,19) |
| InChIKey | MRYPSITXNRYMID-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|