C22H29FO2S — CID 10339515
5-fluoro-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoic acid (PubChem CID 10339515) has the molecular formula C22H29FO2S and a molecular weight of 376.54 g/mol. Its IUPAC name is 5-fluoro-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoic acid.
| Compound Name | 5-fluoro-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 10339515 |
| Molecular Formula | C22H29FO2S |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 5-fluoro-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSc1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C22H29FO2S/c1-16(2)7-5-8-17(3)9-6-10-18(4)13-14-26-21-12-11-19(23)15-20(21)22(24)25/h7,9,11-13,15H,5-6,8,10,14H2,1-4H3,(H,24,25)/b17-9+,18-13+ |
| InChIKey | ALUQZNIXMDURPK-IJUJUXHTSA-N |
| XLogP | 7.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|