C28H50O3 — CID 163081879
(6-hydroxy-2,6-dimethylocta-2,7-dienyl) octadec-9-enoate (PubChem CID 163081879) has the molecular formula C28H50O3 and a molecular weight of 434.71 g/mol. Its IUPAC name is (6-hydroxy-2,6-dimethylocta-2,7-dienyl) octadec-9-enoate.
| Compound Name | (6-hydroxy-2,6-dimethylocta-2,7-dienyl) octadec-9-enoate |
|---|---|
| PubChem CID | 163081879 |
| Molecular Formula | C28H50O3 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.38 |
| IUPAC Name | (6-hydroxy-2,6-dimethylocta-2,7-dienyl) octadec-9-enoate |
| SMILES | C=CC(C)(O)CCC=C(C)COC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C28H50O3/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-27(29)31-25-26(3)22-21-24-28(4,30)6-2/h6,13-14,22,30H,2,5,7-12,15-21,23-25H2,1,3-4H3 |
| InChIKey | RVGVZTLQPGXDBI-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|