About iron(4+);2-methanidylnonyl 2-methylprop-2-enoate
iron(4+);2-methanidylnonyl 2-methylprop-2-enoate (PubChem CID 59117780) has the molecular formula C14H22FeO2
and a molecular weight of 278.17 g/mol. Its IUPAC name is iron(4+);2-methanidylnonyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | iron(4+);2-methanidylnonyl 2-methylprop-2-enoate |
| PubChem CID | 59117780 |
| Molecular Formula | C14H22FeO2 |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | iron(4+);2-methanidylnonyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC([CH2-])C[CH-]C[CH-]CC[CH2-].[Fe+4] |
| InChI | InChI=1S/C14H22O2.Fe/c1-5-6-7-8-9-10-13(4)11-16-14(15)12(2)3;/h7,9,13H,1-2,4-6,8,10-11H2,3H3;/q-4;+4 |
| InChIKey | CLQKYUQSTADUHV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze iron(4+);2-methanidylnonyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(4+);2-methanidylnonyl 2-methylprop-2-enoate?
The IUPAC name of iron(4+);2-methanidylnonyl 2-methylprop-2-enoate (CID 59117780) is iron(4+);2-methanidylnonyl 2-methylprop-2-enoate.
What is the SMILES notation for iron(4+);2-methanidylnonyl 2-methylprop-2-enoate?
The canonical SMILES for iron(4+);2-methanidylnonyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC([CH2-])C[CH-]C[CH-]CC[CH2-].[Fe+4].
What is the InChIKey of iron(4+);2-methanidylnonyl 2-methylprop-2-enoate?
The InChIKey is CLQKYUQSTADUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2.Fe/c1-5-6-7-8-9-10-13(4)11-16-14(15)12(2)3;/h7,9,13H,1-2,4-6,8,10-11H2,3H3;/q-4;+4.
What are the key properties of iron(4+);2-methanidylnonyl 2-methylprop-2-enoate?
iron(4+);2-methanidylnonyl 2-methylprop-2-enoate has a molecular weight of 278.17 g/mol, XLogP of 3.36, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iron(4+);2-methanidylnonyl 2-methylprop-2-enoate is sourced from PubChem (CID 59117780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).