C22H43N2NaO12S2Si — CID 59439714
sodium 3-hydroxy-2-[[3-[3-[2-hydroxy-3-(3-triethoxysilylpropylamino)propoxy]-3-oxopropyl]sulfanyl-2-methylpropanoyl]amino]-3-oxopropane-1-sulfonate (PubChem CID 59439714) has the molecular formula C22H43N2NaO12S2Si and a molecular weight of 642.80 g/mol. Its IUPAC name is sodium 3-hydroxy-2-[[3-[3-[2-hydroxy-3-(3-triethoxysilylpropylamino)propoxy]-3-oxopropyl]sulfanyl-2-methylpropanoyl]amino]-3-oxopropane-1-sulfonate.
| Compound Name | sodium 3-hydroxy-2-[[3-[3-[2-hydroxy-3-(3-triethoxysilylpropylamino)propoxy]-3-oxopropyl]sulfanyl-2-methylpropanoyl]amino]-3-oxopropane-1-sulfonate |
|---|---|
| PubChem CID | 59439714 |
| Molecular Formula | C22H43N2NaO12S2Si |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | sodium 3-hydroxy-2-[[3-[3-[2-hydroxy-3-(3-triethoxysilylpropylamino)propoxy]-3-oxopropyl]sulfanyl-2-methylpropanoyl]amino]-3-oxopropane-1-sulfonate |
| SMILES | CCO[Si](CCCNCC(O)COC(=O)CCSCC(C)C(=O)NC(CS(=O)(=O)[O-])C(=O)O)(OCC)OCC.[Na+] |
| InChI | InChI=1S/C22H44N2O12S2Si.Na/c1-5-34-39(35-6-2,36-7-3)12-8-10-23-13-18(25)14-33-20(26)9-11-37-15-17(4)21(27)24-19(22(28)29)16-38(30,31)32;/h17-19,23,25H,5-16H2,1-4H3,(H,24,27)(H,28,29)(H,30,31,32);/q;+1/p-1 |
| InChIKey | WUQMJFNCWSZBPD-UHFFFAOYSA-M |
| XLogP | -3.20 |
| TPSA | 209.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|