C19H39N2O8S2Si- — CID 58903437
2-[2-methyl-3-[2-[1-(3-triethoxysilylpropylamino)ethenylamino]ethylsulfanyl]propanoyl]oxyethanesulfonate (PubChem CID 58903437) has the molecular formula C19H39N2O8S2Si- and a molecular weight of 515.75 g/mol. Its IUPAC name is 2-[2-methyl-3-[2-[1-(3-triethoxysilylpropylamino)ethenylamino]ethylsulfanyl]propanoyl]oxyethanesulfonate.
| Compound Name | 2-[2-methyl-3-[2-[1-(3-triethoxysilylpropylamino)ethenylamino]ethylsulfanyl]propanoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 58903437 |
| Molecular Formula | C19H39N2O8S2Si- |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 2-[2-methyl-3-[2-[1-(3-triethoxysilylpropylamino)ethenylamino]ethylsulfanyl]propanoyl]oxyethanesulfonate |
| SMILES | C=C(NCCC[Si](OCC)(OCC)OCC)NCCSCC(C)C(=O)OCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H40N2O8S2Si/c1-6-27-32(28-7-2,29-8-3)15-9-10-20-18(5)21-11-13-30-16-17(4)19(22)26-12-14-31(23,24)25/h17,20-21H,5-16H2,1-4H3,(H,23,24,25)/p-1 |
| InChIKey | BTGCNJOZOIWKML-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 135.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|