C15H24O7 — CID 123289262
[2-hydroxy-3-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]propyl] hexa-2,4-dienoate (PubChem CID 123289262) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is [2-hydroxy-3-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]propyl] hexa-2,4-dienoate.
| Compound Name | [2-hydroxy-3-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]propyl] hexa-2,4-dienoate |
|---|---|
| PubChem CID | 123289262 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [2-hydroxy-3-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]propyl] hexa-2,4-dienoate |
| SMILES | CC=CC=CC(=O)OCC(O)COCC(O)COCC1CO1 |
| InChI | InChI=1S/C15H24O7/c1-2-3-4-5-15(18)22-9-13(17)8-19-6-12(16)7-20-10-14-11-21-14/h2-5,12-14,16-17H,6-11H2,1H3 |
| InChIKey | UOYLKVWODRAWOH-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|