C36H66O13Si4 — CID 167649893
3-butanoyloxypropyl 5-tris[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy]silylpentanoate (PubChem CID 167649893) has the molecular formula C36H66O13Si4 and a molecular weight of 819.25 g/mol. Its IUPAC name is 3-butanoyloxypropyl 5-tris[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy]silylpentanoate.
| Compound Name | 3-butanoyloxypropyl 5-tris[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy]silylpentanoate |
|---|---|
| PubChem CID | 167649893 |
| Molecular Formula | C36H66O13Si4 |
| Molecular Weight | 819.25 g/mol |
| Exact Mass | 818.36 |
| IUPAC Name | 3-butanoyloxypropyl 5-tris[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy]silylpentanoate |
| SMILES | C=CC(=O)OCCC[Si](C)(C)O[Si](CCCCC(=O)OCCCOC(=O)CCC)(O[Si](C)(C)CCCOC(=O)C=C)O[Si](C)(C)CCCOC(=O)C=C |
| InChI | InChI=1S/C36H66O13Si4/c1-11-21-35(40)45-23-17-24-46-36(41)22-15-16-31-53(47-50(5,6)28-18-25-42-32(37)12-2,48-51(7,8)29-19-26-43-33(38)13-3)49-52(9,10)30-20-27-44-34(39)14-4/h12-14H,2-4,11,15-31H2,1,5-10H3 |
| InChIKey | CKRVVBSUBVJIPZ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.25 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|