C24H56O8Si6 — CID 140777157
3-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-[(hexyl-methyl-trimethylsilyloxysilyl)oxy-methylsilyl]oxy-methylsilyl]propyl]oxolane-2,5-dione (PubChem CID 140777157) has the molecular formula C24H56O8Si6 and a molecular weight of 641.22 g/mol. Its IUPAC name is 3-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-[(hexyl-methyl-trimethylsilyloxysilyl)oxy-methylsilyl]oxy-methylsilyl]propyl]oxolane-2,5-dione.
| Compound Name | 3-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-[(hexyl-methyl-trimethylsilyloxysilyl)oxy-methylsilyl]oxy-methylsilyl]propyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 140777157 |
| Molecular Formula | C24H56O8Si6 |
| Molecular Weight | 641.22 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | 3-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-[(hexyl-methyl-trimethylsilyloxysilyl)oxy-methylsilyl]oxy-methylsilyl]propyl]oxolane-2,5-dione |
| SMILES | CCCCCC[Si](C)(O[SiH](C)O[Si](C)(CCCC1CC(=O)OC1=O)O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H56O8Si6/c1-13-14-15-16-19-37(11,31-35(6,7)8)28-33(2)29-38(12,32-36(9,10)30-34(3,4)5)20-17-18-22-21-23(25)27-24(22)26/h22,33H,13-21H2,1-12H3 |
| InChIKey | HNSHHBKQFCRLPP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.22 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|