C16H30O6Si — CID 152641894
3-(3-tripropoxysilylpropyl)oxolane-2,5-dione (PubChem CID 152641894) has the molecular formula C16H30O6Si and a molecular weight of 346.50 g/mol. Its IUPAC name is 3-(3-tripropoxysilylpropyl)oxolane-2,5-dione.
| Compound Name | 3-(3-tripropoxysilylpropyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 152641894 |
| Molecular Formula | C16H30O6Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3-(3-tripropoxysilylpropyl)oxolane-2,5-dione |
| SMILES | CCCO[Si](CCCC1CC(=O)OC1=O)(OCCC)OCCC |
| InChI | InChI=1S/C16H30O6Si/c1-4-9-19-23(20-10-5-2,21-11-6-3)12-7-8-14-13-15(17)22-16(14)18/h14H,4-13H2,1-3H3 |
| InChIKey | ZFSZMJMTAYRNCJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|