C14H26O7Si — CID 142624035
3-(3-triethoxysilylpropoxymethyl)oxolane-2,5-dione (PubChem CID 142624035) has the molecular formula C14H26O7Si and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-(3-triethoxysilylpropoxymethyl)oxolane-2,5-dione.
| Compound Name | 3-(3-triethoxysilylpropoxymethyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 142624035 |
| Molecular Formula | C14H26O7Si |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-(3-triethoxysilylpropoxymethyl)oxolane-2,5-dione |
| SMILES | CCO[Si](CCCOCC1CC(=O)OC1=O)(OCC)OCC |
| InChI | InChI=1S/C14H26O7Si/c1-4-18-22(19-5-2,20-6-3)9-7-8-17-11-12-10-13(15)21-14(12)16/h12H,4-11H2,1-3H3 |
| InChIKey | SYRLXJGRVSKVRW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|