C11H22O4Si2 — CID 140795995
3-[3-[dimethylsilyloxy(dimethyl)silyl]propyl]oxolane-2,5-dione (PubChem CID 140795995) has the molecular formula C11H22O4Si2 and a molecular weight of 274.46 g/mol. Its IUPAC name is 3-[3-[dimethylsilyloxy(dimethyl)silyl]propyl]oxolane-2,5-dione.
| Compound Name | 3-[3-[dimethylsilyloxy(dimethyl)silyl]propyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 140795995 |
| Molecular Formula | C11H22O4Si2 |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-[3-[dimethylsilyloxy(dimethyl)silyl]propyl]oxolane-2,5-dione |
| SMILES | C[SiH](C)O[Si](C)(C)CCCC1CC(=O)OC1=O |
| InChI | InChI=1S/C11H22O4Si2/c1-16(2)15-17(3,4)7-5-6-9-8-10(12)14-11(9)13/h9,16H,5-8H2,1-4H3 |
| InChIKey | VVGQVFNHWCZLGK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|